C30H45ClN2O5S — CID 141320691
N-[2-butyl-3-[4-[3-(dibutylamino)propoxy]phenoxy]-1-benzofuran-5-yl]methanesulfonamide;hydrochloride (PubChem CID 141320691) has the molecular formula C30H45ClN2O5S and a molecular weight of 581.22 g/mol. Its IUPAC name is N-[2-butyl-3-[4-[3-(dibutylamino)propoxy]phenoxy]-1-benzofuran-5-yl]methanesulfonamide;hydrochloride.
| Compound Name | N-[2-butyl-3-[4-[3-(dibutylamino)propoxy]phenoxy]-1-benzofuran-5-yl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 141320691 |
| Molecular Formula | C30H45ClN2O5S |
| Molecular Weight | 581.22 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | N-[2-butyl-3-[4-[3-(dibutylamino)propoxy]phenoxy]-1-benzofuran-5-yl]methanesulfonamide;hydrochloride |
| SMILES | CCCCc1oc2ccc(NS(C)(=O)=O)cc2c1Oc1ccc(OCCCN(CCCC)CCCC)cc1.Cl |
| InChI | InChI=1S/C30H44N2O5S.ClH/c1-5-8-12-29-30(27-23-24(31-38(4,33)34)13-18-28(27)37-29)36-26-16-14-25(15-17-26)35-22-11-21-32(19-9-6-2)20-10-7-3;/h13-18,23,31H,5-12,19-22H2,1-4H3;1H |
| InChIKey | MSZXMNKCMLTXCL-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.22 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|