C31H45ClN2O5S — CID 72734946
N-[3-[4-[3-[bis(1,1-dideuteriobutyl)amino]-1,1,2,2,3,3-hexadeuteriopropoxy]benzoyl]-2-butyl-1-benzofuran-5-yl]methanesulfonamide;hydrochloride (PubChem CID 72734946) has the molecular formula C31H45ClN2O5S and a molecular weight of 603.29 g/mol. Its IUPAC name is N-[3-[4-[3-[bis(1,1-dideuteriobutyl)amino]-1,1,2,2,3,3-hexadeuteriopropoxy]benzoyl]-2-butyl-1-benzofuran-5-yl]methanesulfonamide;hydrochloride.
| Compound Name | N-[3-[4-[3-[bis(1,1-dideuteriobutyl)amino]-1,1,2,2,3,3-hexadeuteriopropoxy]benzoyl]-2-butyl-1-benzofuran-5-yl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 72734946 |
| Molecular Formula | C31H45ClN2O5S |
| Molecular Weight | 603.29 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | N-[3-[4-[3-[bis(1,1-dideuteriobutyl)amino]-1,1,2,2,3,3-hexadeuteriopropoxy]benzoyl]-2-butyl-1-benzofuran-5-yl]methanesulfonamide;hydrochloride |
| SMILES | Cl.[2H]C([2H])(CCC)N(C([2H])([2H])CCC)C([2H])([2H])C([2H])([2H])C([2H])([2H])Oc1ccc(C(=O)c2c(CCCC)oc3ccc(NS(C)(=O)=O)cc23)cc1 |
| InChI | InChI=1S/C31H44N2O5S.ClH/c1-5-8-12-29-30(27-23-25(32-39(4,35)36)15-18-28(27)38-29)31(34)24-13-16-26(17-14-24)37-22-11-21-33(19-9-6-2)20-10-7-3;/h13-18,23,32H,5-12,19-22H2,1-4H3;1H/i11D2,19D2,20D2,21D2,22D2; |
| InChIKey | DWKVCQXJYURSIQ-WSWTWNSZSA-N |
| XLogP | 7.47 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.29 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |