C29H38N2O7S2 — CID 141449435
N-[2-butyl-3-[3-methylsulfonyl-4-(3-piperidin-1-ylpropoxy)benzoyl]-1-benzofuran-5-yl]methanesulfonamide (PubChem CID 141449435) has the molecular formula C29H38N2O7S2 and a molecular weight of 590.76 g/mol. Its IUPAC name is N-[2-butyl-3-[3-methylsulfonyl-4-(3-piperidin-1-ylpropoxy)benzoyl]-1-benzofuran-5-yl]methanesulfonamide.
| Compound Name | N-[2-butyl-3-[3-methylsulfonyl-4-(3-piperidin-1-ylpropoxy)benzoyl]-1-benzofuran-5-yl]methanesulfonamide |
|---|---|
| PubChem CID | 141449435 |
| Molecular Formula | C29H38N2O7S2 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | N-[2-butyl-3-[3-methylsulfonyl-4-(3-piperidin-1-ylpropoxy)benzoyl]-1-benzofuran-5-yl]methanesulfonamide |
| SMILES | CCCCc1oc2ccc(NS(C)(=O)=O)cc2c1C(=O)c1ccc(OCCCN2CCCCC2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C29H38N2O7S2/c1-4-5-10-26-28(23-20-22(30-40(3,35)36)12-14-24(23)38-26)29(32)21-11-13-25(27(19-21)39(2,33)34)37-18-9-17-31-15-7-6-8-16-31/h11-14,19-20,30H,4-10,15-18H2,1-3H3 |
| InChIKey | WRYHSLHRLWADSE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|