C29H34F4N2O5S — CID 141423321
N-[2-butyl-6-fluoro-3-[4-(3-piperidin-1-ylpropoxy)-3-(trifluoromethyl)benzoyl]-1-benzofuran-5-yl]methanesulfonamide (PubChem CID 141423321) has the molecular formula C29H34F4N2O5S and a molecular weight of 598.66 g/mol. Its IUPAC name is N-[2-butyl-6-fluoro-3-[4-(3-piperidin-1-ylpropoxy)-3-(trifluoromethyl)benzoyl]-1-benzofuran-5-yl]methanesulfonamide.
| Compound Name | N-[2-butyl-6-fluoro-3-[4-(3-piperidin-1-ylpropoxy)-3-(trifluoromethyl)benzoyl]-1-benzofuran-5-yl]methanesulfonamide |
|---|---|
| PubChem CID | 141423321 |
| Molecular Formula | C29H34F4N2O5S |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | N-[2-butyl-6-fluoro-3-[4-(3-piperidin-1-ylpropoxy)-3-(trifluoromethyl)benzoyl]-1-benzofuran-5-yl]methanesulfonamide |
| SMILES | CCCCc1oc2cc(F)c(NS(C)(=O)=O)cc2c1C(=O)c1ccc(OCCCN2CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H34F4N2O5S/c1-3-4-9-25-27(20-17-23(34-41(2,37)38)22(30)18-26(20)40-25)28(36)19-10-11-24(21(16-19)29(31,32)33)39-15-8-14-35-12-6-5-7-13-35/h10-11,16-18,34H,3-9,12-15H2,1-2H3 |
| InChIKey | LYVGLLCBNLZOSC-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|