C25H26F2N2O5 — CID 141423333
(2-butyl-5-nitro-1-benzofuran-3-yl)-[3,5-difluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]methanone (PubChem CID 141423333) has the molecular formula C25H26F2N2O5 and a molecular weight of 472.49 g/mol. Its IUPAC name is (2-butyl-5-nitro-1-benzofuran-3-yl)-[3,5-difluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]methanone.
| Compound Name | (2-butyl-5-nitro-1-benzofuran-3-yl)-[3,5-difluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 141423333 |
| Molecular Formula | C25H26F2N2O5 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | (2-butyl-5-nitro-1-benzofuran-3-yl)-[3,5-difluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]methanone |
| SMILES | CCCCc1oc2ccc([N+](=O)[O-])cc2c1C(=O)c1cc(F)c(OCCN2CCCC2)c(F)c1 |
| InChI | InChI=1S/C25H26F2N2O5/c1-2-3-6-22-23(18-15-17(29(31)32)7-8-21(18)34-22)24(30)16-13-19(26)25(20(27)14-16)33-12-11-28-9-4-5-10-28/h7-8,13-15H,2-6,9-12H2,1H3 |
| InChIKey | ATANUXCGBGFRNN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 85.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|