C32H34N2O7 — CID 10231245
methyl 2-butyl-3-[4-[2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethoxy]benzoyl]-1-benzofuran-5-carboxylate (PubChem CID 10231245) has the molecular formula C32H34N2O7 and a molecular weight of 558.63 g/mol. Its IUPAC name is methyl 2-butyl-3-[4-[2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethoxy]benzoyl]-1-benzofuran-5-carboxylate.
| Compound Name | methyl 2-butyl-3-[4-[2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethoxy]benzoyl]-1-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 10231245 |
| Molecular Formula | C32H34N2O7 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | methyl 2-butyl-3-[4-[2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethoxy]benzoyl]-1-benzofuran-5-carboxylate |
| SMILES | CCCCc1oc2ccc(C(=O)OC)cc2c1C(=O)c1ccc(OCCN(C)CCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C32H34N2O7/c1-4-5-6-29-30(27-21-24(32(36)39-3)11-16-28(27)41-29)31(35)23-9-14-26(15-10-23)40-20-19-33(2)18-17-22-7-12-25(13-8-22)34(37)38/h7-16,21H,4-6,17-20H2,1-3H3 |
| InChIKey | JSMQYKJTPKVISO-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 112.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|