C35H47NO8 — CID 22319716
oxalic acid;propan-2-yl 2-butyl-3-[4-[2-(dibutylamino)ethyl]benzoyl]-1-benzofuran-5-carboxylate (PubChem CID 22319716) has the molecular formula C35H47NO8 and a molecular weight of 609.76 g/mol. Its IUPAC name is oxalic acid;propan-2-yl 2-butyl-3-[4-[2-(dibutylamino)ethyl]benzoyl]-1-benzofuran-5-carboxylate.
| Compound Name | oxalic acid;propan-2-yl 2-butyl-3-[4-[2-(dibutylamino)ethyl]benzoyl]-1-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 22319716 |
| Molecular Formula | C35H47NO8 |
| Molecular Weight | 609.76 g/mol |
| Exact Mass | 609.33 |
| IUPAC Name | oxalic acid;propan-2-yl 2-butyl-3-[4-[2-(dibutylamino)ethyl]benzoyl]-1-benzofuran-5-carboxylate |
| SMILES | CCCCc1oc2ccc(C(=O)OC(C)C)cc2c1C(=O)c1ccc(CCN(CCCC)CCCC)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C33H45NO4.C2H2O4/c1-6-9-12-30-31(28-23-27(17-18-29(28)38-30)33(36)37-24(4)5)32(35)26-15-13-25(14-16-26)19-22-34(20-10-7-2)21-11-8-3;3-1(4)2(5)6/h13-18,23-24H,6-12,19-22H2,1-5H3;(H,3,4)(H,5,6) |
| InChIKey | PBPHMHZXGALNNZ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.76 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|