C31H41NO4 — CID 142116446
3-[4-[3-(dibutylamino)propyl]benzoyl]-2-(4-hydroxybutyl)-1-benzofuran-5-carbaldehyde (PubChem CID 142116446) has the molecular formula C31H41NO4 and a molecular weight of 491.67 g/mol. Its IUPAC name is 3-[4-[3-(dibutylamino)propyl]benzoyl]-2-(4-hydroxybutyl)-1-benzofuran-5-carbaldehyde.
| Compound Name | 3-[4-[3-(dibutylamino)propyl]benzoyl]-2-(4-hydroxybutyl)-1-benzofuran-5-carbaldehyde |
|---|---|
| PubChem CID | 142116446 |
| Molecular Formula | C31H41NO4 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | 3-[4-[3-(dibutylamino)propyl]benzoyl]-2-(4-hydroxybutyl)-1-benzofuran-5-carbaldehyde |
| SMILES | CCCCN(CCCC)CCCc1ccc(C(=O)c2c(CCCCO)oc3ccc(C=O)cc23)cc1 |
| InChI | InChI=1S/C31H41NO4/c1-3-5-18-32(19-6-4-2)20-9-10-24-12-15-26(16-13-24)31(35)30-27-22-25(23-34)14-17-28(27)36-29(30)11-7-8-21-33/h12-17,22-23,33H,3-11,18-21H2,1-2H3 |
| InChIKey | DREIGRWEMYRQSV-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|