C34H46N2O8 — CID 172984668
[2-butyl-5-[(E)-methoxyiminomethyl]-1-benzofuran-3-yl]-[4-[3-(dibutylamino)propoxy]phenyl]methanone;oxalic acid (PubChem CID 172984668) has the molecular formula C34H46N2O8 and a molecular weight of 610.75 g/mol. Its IUPAC name is [2-butyl-5-[(E)-methoxyiminomethyl]-1-benzofuran-3-yl]-[4-[3-(dibutylamino)propoxy]phenyl]methanone;oxalic acid.
| Compound Name | [2-butyl-5-[(E)-methoxyiminomethyl]-1-benzofuran-3-yl]-[4-[3-(dibutylamino)propoxy]phenyl]methanone;oxalic acid |
|---|---|
| PubChem CID | 172984668 |
| Molecular Formula | C34H46N2O8 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | [2-butyl-5-[(E)-methoxyiminomethyl]-1-benzofuran-3-yl]-[4-[3-(dibutylamino)propoxy]phenyl]methanone;oxalic acid |
| SMILES | CCCCc1oc2ccc(/C=N/OC)cc2c1C(=O)c1ccc(OCCCN(CCCC)CCCC)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C32H44N2O4.C2H2O4/c1-5-8-12-30-31(28-23-25(24-33-36-4)13-18-29(28)38-30)32(35)26-14-16-27(17-15-26)37-22-11-21-34(19-9-6-2)20-10-7-3;3-1(4)2(5)6/h13-18,23-24H,5-12,19-22H2,1-4H3;(H,3,4)(H,5,6)/b33-24+; |
| InChIKey | UKTDCKOUPHPJRO-IFOLKCQPSA-N |
| XLogP | 6.81 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|