C37H53N3O4 — CID 164623650
1-[2-butyl-3-[4-[3-(dibutylamino)propoxy]benzoyl]-1-benzofuran-5-yl]-3-cyclohexylurea (PubChem CID 164623650) has the molecular formula C37H53N3O4 and a molecular weight of 603.85 g/mol. Its IUPAC name is 1-[2-butyl-3-[4-[3-(dibutylamino)propoxy]benzoyl]-1-benzofuran-5-yl]-3-cyclohexylurea.
| Compound Name | 1-[2-butyl-3-[4-[3-(dibutylamino)propoxy]benzoyl]-1-benzofuran-5-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 164623650 |
| Molecular Formula | C37H53N3O4 |
| Molecular Weight | 603.85 g/mol |
| Exact Mass | 603.40 |
| IUPAC Name | 1-[2-butyl-3-[4-[3-(dibutylamino)propoxy]benzoyl]-1-benzofuran-5-yl]-3-cyclohexylurea |
| SMILES | CCCCc1oc2ccc(NC(=O)NC3CCCCC3)cc2c1C(=O)c1ccc(OCCCN(CCCC)CCCC)cc1 |
| InChI | InChI=1S/C37H53N3O4/c1-4-7-16-34-35(32-27-30(19-22-33(32)44-34)39-37(42)38-29-14-11-10-12-15-29)36(41)28-17-20-31(21-18-28)43-26-13-25-40(23-8-5-2)24-9-6-3/h17-22,27,29H,4-16,23-26H2,1-3H3,(H2,38,39,42) |
| InChIKey | XBWKCKRQBNVHEP-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.85 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|