C25H31I3NO3+ — CID 161065087
3-[4-(2-butyl-1-benzofuran-3-carbonyl)-2,6-diiodophenoxy]propyl-trimethylazanium;hydroiodide (PubChem CID 161065087) has the molecular formula C25H31I3NO3+ and a molecular weight of 774.24 g/mol. Its IUPAC name is 3-[4-(2-butyl-1-benzofuran-3-carbonyl)-2,6-diiodophenoxy]propyl-trimethylazanium;hydroiodide.
| Compound Name | 3-[4-(2-butyl-1-benzofuran-3-carbonyl)-2,6-diiodophenoxy]propyl-trimethylazanium;hydroiodide |
|---|---|
| PubChem CID | 161065087 |
| Molecular Formula | C25H31I3NO3+ |
| Molecular Weight | 774.24 g/mol |
| Exact Mass | 773.94 |
| IUPAC Name | 3-[4-(2-butyl-1-benzofuran-3-carbonyl)-2,6-diiodophenoxy]propyl-trimethylazanium;hydroiodide |
| SMILES | CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCCC[N+](C)(C)C)c(I)c1.I |
| InChI | InChI=1S/C25H30I2NO3.HI/c1-5-6-11-22-23(18-10-7-8-12-21(18)31-22)24(29)17-15-19(26)25(20(27)16-17)30-14-9-13-28(2,3)4;/h7-8,10,12,15-16H,5-6,9,11,13-14H2,1-4H3;1H/q+1; |
| InChIKey | PXOYAAYHENLPHG-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.24 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|