C22H21ClI2O4 — CID 54236675
(2-butyl-1-benzofuran-3-yl)-[4-(3-chloro-2-hydroxypropoxy)-3,5-diiodophenyl]methanone (PubChem CID 54236675) has the molecular formula C22H21ClI2O4 and a molecular weight of 638.67 g/mol. Its IUPAC name is (2-butyl-1-benzofuran-3-yl)-[4-(3-chloro-2-hydroxypropoxy)-3,5-diiodophenyl]methanone.
| Compound Name | (2-butyl-1-benzofuran-3-yl)-[4-(3-chloro-2-hydroxypropoxy)-3,5-diiodophenyl]methanone |
|---|---|
| PubChem CID | 54236675 |
| Molecular Formula | C22H21ClI2O4 |
| Molecular Weight | 638.67 g/mol |
| Exact Mass | 637.92 |
| IUPAC Name | (2-butyl-1-benzofuran-3-yl)-[4-(3-chloro-2-hydroxypropoxy)-3,5-diiodophenyl]methanone |
| SMILES | CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCC(O)CCl)c(I)c1 |
| InChI | InChI=1S/C22H21ClI2O4/c1-2-3-7-19-20(15-6-4-5-8-18(15)29-19)21(27)13-9-16(24)22(17(25)10-13)28-12-14(26)11-23/h4-6,8-10,14,26H,2-3,7,11-12H2,1H3 |
| InChIKey | QNBFUUIVKKDVTL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.67 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|