C14H17NO2 — CID 141114520
2-butyl-N-methyl-1-benzofuran-3-carboxamide (PubChem CID 141114520) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-butyl-N-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 2-butyl-N-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 141114520 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-butyl-N-methyl-1-benzofuran-3-carboxamide |
| SMILES | CCCCc1oc2ccccc2c1C(=O)NC |
| InChI | InChI=1S/C14H17NO2/c1-3-4-8-12-13(14(16)15-2)10-7-5-6-9-11(10)17-12/h5-7,9H,3-4,8H2,1-2H3,(H,15,16) |
| InChIKey | IRWQDDFFWPHGOK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |