C24H22BrNO3 — CID 86587378
N-[(5-bromo-6-hydroxynaphthalen-2-yl)methyl]-2-butyl-1-benzofuran-3-carboxamide (PubChem CID 86587378) has the molecular formula C24H22BrNO3 and a molecular weight of 452.35 g/mol. Its IUPAC name is N-[(5-bromo-6-hydroxynaphthalen-2-yl)methyl]-2-butyl-1-benzofuran-3-carboxamide.
| Compound Name | N-[(5-bromo-6-hydroxynaphthalen-2-yl)methyl]-2-butyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 86587378 |
| Molecular Formula | C24H22BrNO3 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | N-[(5-bromo-6-hydroxynaphthalen-2-yl)methyl]-2-butyl-1-benzofuran-3-carboxamide |
| SMILES | CCCCc1oc2ccccc2c1C(=O)NCc1ccc2c(Br)c(O)ccc2c1 |
| InChI | InChI=1S/C24H22BrNO3/c1-2-3-7-21-22(18-6-4-5-8-20(18)29-21)24(28)26-14-15-9-11-17-16(13-15)10-12-19(27)23(17)25/h4-6,8-13,27H,2-3,7,14H2,1H3,(H,26,28) |
| InChIKey | VKCZQTCJJHGBEP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |