C25H24BrNO3 — CID 86587384
N-[(5-bromo-6-hydroxynaphthalen-2-yl)methyl]-2-butyl-N-methyl-1-benzofuran-3-carboxamide (PubChem CID 86587384) has the molecular formula C25H24BrNO3 and a molecular weight of 466.38 g/mol. Its IUPAC name is N-[(5-bromo-6-hydroxynaphthalen-2-yl)methyl]-2-butyl-N-methyl-1-benzofuran-3-carboxamide.
| Compound Name | N-[(5-bromo-6-hydroxynaphthalen-2-yl)methyl]-2-butyl-N-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 86587384 |
| Molecular Formula | C25H24BrNO3 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | N-[(5-bromo-6-hydroxynaphthalen-2-yl)methyl]-2-butyl-N-methyl-1-benzofuran-3-carboxamide |
| SMILES | CCCCc1oc2ccccc2c1C(=O)N(C)Cc1ccc2c(Br)c(O)ccc2c1 |
| InChI | InChI=1S/C25H24BrNO3/c1-3-4-8-22-23(19-7-5-6-9-21(19)30-22)25(29)27(2)15-16-10-12-18-17(14-16)11-13-20(28)24(18)26/h5-7,9-14,28H,3-4,8,15H2,1-2H3 |
| InChIKey | HUKNEKRNHVQQGY-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |