C20H16I2O5 — CID 18355460
ethyl 3-[3-(4-hydroxy-3,5-diiodobenzoyl)-1-benzofuran-2-yl]propanoate (PubChem CID 18355460) has the molecular formula C20H16I2O5 and a molecular weight of 590.15 g/mol. Its IUPAC name is ethyl 3-[3-(4-hydroxy-3,5-diiodobenzoyl)-1-benzofuran-2-yl]propanoate.
| Compound Name | ethyl 3-[3-(4-hydroxy-3,5-diiodobenzoyl)-1-benzofuran-2-yl]propanoate |
|---|---|
| PubChem CID | 18355460 |
| Molecular Formula | C20H16I2O5 |
| Molecular Weight | 590.15 g/mol |
| Exact Mass | 589.91 |
| IUPAC Name | ethyl 3-[3-(4-hydroxy-3,5-diiodobenzoyl)-1-benzofuran-2-yl]propanoate |
| SMILES | CCOC(=O)CCc1oc2ccccc2c1C(=O)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C20H16I2O5/c1-2-26-17(23)8-7-16-18(12-5-3-4-6-15(12)27-16)19(24)11-9-13(21)20(25)14(22)10-11/h3-6,9-10,25H,2,7-8H2,1H3 |
| InChIKey | KJEOQZCJVUOFHQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.15 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|