C30H27I2NO5 — CID 161035221
6-[3-(4-hydroxy-3,5-diiodobenzoyl)-6-(3-phenylprop-1-en-2-yloxy)-1-benzofuran-2-yl]hexanamide (PubChem CID 161035221) has the molecular formula C30H27I2NO5 and a molecular weight of 735.36 g/mol. Its IUPAC name is 6-[3-(4-hydroxy-3,5-diiodobenzoyl)-6-(3-phenylprop-1-en-2-yloxy)-1-benzofuran-2-yl]hexanamide.
| Compound Name | 6-[3-(4-hydroxy-3,5-diiodobenzoyl)-6-(3-phenylprop-1-en-2-yloxy)-1-benzofuran-2-yl]hexanamide |
|---|---|
| PubChem CID | 161035221 |
| Molecular Formula | C30H27I2NO5 |
| Molecular Weight | 735.36 g/mol |
| Exact Mass | 735.00 |
| IUPAC Name | 6-[3-(4-hydroxy-3,5-diiodobenzoyl)-6-(3-phenylprop-1-en-2-yloxy)-1-benzofuran-2-yl]hexanamide |
| SMILES | C=C(Cc1ccccc1)Oc1ccc2c(C(=O)c3cc(I)c(O)c(I)c3)c(CCCCCC(N)=O)oc2c1 |
| InChI | InChI=1S/C30H27I2NO5/c1-18(14-19-8-4-2-5-9-19)37-21-12-13-22-26(17-21)38-25(10-6-3-7-11-27(33)34)28(22)29(35)20-15-23(31)30(36)24(32)16-20/h2,4-5,8-9,12-13,15-17,36H,1,3,6-7,10-11,14H2,(H2,33,34) |
| InChIKey | ADGGQOVPJXWZGD-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.36 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|