C25H29N3O5 — CID 162065441
4-[3-(3,5-diamino-4-hydroxybenzoyl)-6-hex-1-en-2-yloxy-1-benzofuran-2-yl]butanamide (PubChem CID 162065441) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 4-[3-(3,5-diamino-4-hydroxybenzoyl)-6-hex-1-en-2-yloxy-1-benzofuran-2-yl]butanamide.
| Compound Name | 4-[3-(3,5-diamino-4-hydroxybenzoyl)-6-hex-1-en-2-yloxy-1-benzofuran-2-yl]butanamide |
|---|---|
| PubChem CID | 162065441 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 4-[3-(3,5-diamino-4-hydroxybenzoyl)-6-hex-1-en-2-yloxy-1-benzofuran-2-yl]butanamide |
| SMILES | C=C(CCCC)Oc1ccc2c(C(=O)c3cc(N)c(O)c(N)c3)c(CCCC(N)=O)oc2c1 |
| InChI | InChI=1S/C25H29N3O5/c1-3-4-6-14(2)32-16-9-10-17-21(13-16)33-20(7-5-8-22(28)29)23(17)24(30)15-11-18(26)25(31)19(27)12-15/h9-13,31H,2-8,26-27H2,1H3,(H2,28,29) |
| InChIKey | ARIZKKVHAUUJSP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 154.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|