C26H26N2O4 — CID 139569302
(3,5-diamino-4-hydroxyphenyl)-[6-(2-phenylethoxy)-2-propyl-1-benzofuran-3-yl]methanone (PubChem CID 139569302) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is (3,5-diamino-4-hydroxyphenyl)-[6-(2-phenylethoxy)-2-propyl-1-benzofuran-3-yl]methanone.
| Compound Name | (3,5-diamino-4-hydroxyphenyl)-[6-(2-phenylethoxy)-2-propyl-1-benzofuran-3-yl]methanone |
|---|---|
| PubChem CID | 139569302 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (3,5-diamino-4-hydroxyphenyl)-[6-(2-phenylethoxy)-2-propyl-1-benzofuran-3-yl]methanone |
| SMILES | CCCc1oc2cc(OCCc3ccccc3)ccc2c1C(=O)c1cc(N)c(O)c(N)c1 |
| InChI | InChI=1S/C26H26N2O4/c1-2-6-22-24(25(29)17-13-20(27)26(30)21(28)14-17)19-10-9-18(15-23(19)32-22)31-12-11-16-7-4-3-5-8-16/h3-5,7-10,13-15,30H,2,6,11-12,27-28H2,1H3 |
| InChIKey | RNVBYWJTTJFNNT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|