C26H33NO3 — CID 13423021
[4-[3-(2,2-dimethylpropylamino)propoxy]phenyl]-(2-propyl-1-benzofuran-3-yl)methanone (PubChem CID 13423021) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is [4-[3-(2,2-dimethylpropylamino)propoxy]phenyl]-(2-propyl-1-benzofuran-3-yl)methanone.
| Compound Name | [4-[3-(2,2-dimethylpropylamino)propoxy]phenyl]-(2-propyl-1-benzofuran-3-yl)methanone |
|---|---|
| PubChem CID | 13423021 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | [4-[3-(2,2-dimethylpropylamino)propoxy]phenyl]-(2-propyl-1-benzofuran-3-yl)methanone |
| SMILES | CCCc1oc2ccccc2c1C(=O)c1ccc(OCCCNCC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H33NO3/c1-5-9-23-24(21-10-6-7-11-22(21)30-23)25(28)19-12-14-20(15-13-19)29-17-8-16-27-18-26(2,3)4/h6-7,10-15,27H,5,8-9,16-18H2,1-4H3 |
| InChIKey | OZJVMYLDQREZNT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|