C29H28F3NO3 — CID 51349518
[2-[4-[3-(diethylamino)propoxy]phenyl]-1-benzofuran-3-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 51349518) has the molecular formula C29H28F3NO3 and a molecular weight of 495.54 g/mol. Its IUPAC name is [2-[4-[3-(diethylamino)propoxy]phenyl]-1-benzofuran-3-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [2-[4-[3-(diethylamino)propoxy]phenyl]-1-benzofuran-3-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 51349518 |
| Molecular Formula | C29H28F3NO3 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | [2-[4-[3-(diethylamino)propoxy]phenyl]-1-benzofuran-3-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | CCN(CC)CCCOc1ccc(-c2oc3ccccc3c2C(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H28F3NO3/c1-3-33(4-2)18-7-19-35-23-16-12-21(13-17-23)28-26(24-8-5-6-9-25(24)36-28)27(34)20-10-14-22(15-11-20)29(30,31)32/h5-6,8-17H,3-4,7,18-19H2,1-2H3 |
| InChIKey | MUQHBYHSYQRLBU-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|