C31H35NO4 — CID 21435375
[4-[3-(diethylamino)propoxy]phenyl]-[2-(4-propoxyphenyl)-1-benzofuran-3-yl]methanone (PubChem CID 21435375) has the molecular formula C31H35NO4 and a molecular weight of 485.62 g/mol. Its IUPAC name is [4-[3-(diethylamino)propoxy]phenyl]-[2-(4-propoxyphenyl)-1-benzofuran-3-yl]methanone.
| Compound Name | [4-[3-(diethylamino)propoxy]phenyl]-[2-(4-propoxyphenyl)-1-benzofuran-3-yl]methanone |
|---|---|
| PubChem CID | 21435375 |
| Molecular Formula | C31H35NO4 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | [4-[3-(diethylamino)propoxy]phenyl]-[2-(4-propoxyphenyl)-1-benzofuran-3-yl]methanone |
| SMILES | CCCOc1ccc(-c2oc3ccccc3c2C(=O)c2ccc(OCCCN(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C31H35NO4/c1-4-21-34-25-18-14-24(15-19-25)31-29(27-10-7-8-11-28(27)36-31)30(33)23-12-16-26(17-13-23)35-22-9-20-32(5-2)6-3/h7-8,10-19H,4-6,9,20-22H2,1-3H3 |
| InChIKey | SJQZEJZKSXYNBY-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|