C32H37NO3 — CID 21435354
[4-[3-(diethylamino)propoxy]-3,5-dimethylphenyl]-[2-(3,5-dimethylphenyl)-1-benzofuran-3-yl]methanone (PubChem CID 21435354) has the molecular formula C32H37NO3 and a molecular weight of 483.65 g/mol. Its IUPAC name is [4-[3-(diethylamino)propoxy]-3,5-dimethylphenyl]-[2-(3,5-dimethylphenyl)-1-benzofuran-3-yl]methanone.
| Compound Name | [4-[3-(diethylamino)propoxy]-3,5-dimethylphenyl]-[2-(3,5-dimethylphenyl)-1-benzofuran-3-yl]methanone |
|---|---|
| PubChem CID | 21435354 |
| Molecular Formula | C32H37NO3 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | [4-[3-(diethylamino)propoxy]-3,5-dimethylphenyl]-[2-(3,5-dimethylphenyl)-1-benzofuran-3-yl]methanone |
| SMILES | CCN(CC)CCCOc1c(C)cc(C(=O)c2c(-c3cc(C)cc(C)c3)oc3ccccc23)cc1C |
| InChI | InChI=1S/C32H37NO3/c1-7-33(8-2)14-11-15-35-31-23(5)19-25(20-24(31)6)30(34)29-27-12-9-10-13-28(27)36-32(29)26-17-21(3)16-22(4)18-26/h9-10,12-13,16-20H,7-8,11,14-15H2,1-6H3 |
| InChIKey | IMPPEDMIQJIQSO-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|