C30H37NO2 — CID 21331744
1-[4-[3-(diethylamino)propoxy]-3,5-dimethylphenyl]-3,3-diphenylpropan-1-one (PubChem CID 21331744) has the molecular formula C30H37NO2 and a molecular weight of 443.63 g/mol. Its IUPAC name is 1-[4-[3-(diethylamino)propoxy]-3,5-dimethylphenyl]-3,3-diphenylpropan-1-one.
| Compound Name | 1-[4-[3-(diethylamino)propoxy]-3,5-dimethylphenyl]-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 21331744 |
| Molecular Formula | C30H37NO2 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 1-[4-[3-(diethylamino)propoxy]-3,5-dimethylphenyl]-3,3-diphenylpropan-1-one |
| SMILES | CCN(CC)CCCOc1c(C)cc(C(=O)CC(c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C30H37NO2/c1-5-31(6-2)18-13-19-33-30-23(3)20-27(21-24(30)4)29(32)22-28(25-14-9-7-10-15-25)26-16-11-8-12-17-26/h7-12,14-17,20-21,28H,5-6,13,18-19,22H2,1-4H3 |
| InChIKey | HWDUTOXIINWZIL-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|