C19H30BrNO5 — CID 3039007
5-bromo-N-[2-(2,6-dimethylphenoxy)ethyl]-N-ethylpentan-1-amine;oxalic acid (PubChem CID 3039007) has the molecular formula C19H30BrNO5 and a molecular weight of 432.36 g/mol. Its IUPAC name is 5-bromo-N-[2-(2,6-dimethylphenoxy)ethyl]-N-ethylpentan-1-amine;oxalic acid.
| Compound Name | 5-bromo-N-[2-(2,6-dimethylphenoxy)ethyl]-N-ethylpentan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 3039007 |
| Molecular Formula | C19H30BrNO5 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 5-bromo-N-[2-(2,6-dimethylphenoxy)ethyl]-N-ethylpentan-1-amine;oxalic acid |
| SMILES | CCN(CCCCCBr)CCOc1c(C)cccc1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H28BrNO.C2H2O4/c1-4-19(12-7-5-6-11-18)13-14-20-17-15(2)9-8-10-16(17)3;3-1(4)2(5)6/h8-10H,4-7,11-14H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | DKPHQPOYNSZPEV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|