C18H30O — CID 83057478
2-decoxy-1,3-dimethylbenzene (PubChem CID 83057478) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 2-decoxy-1,3-dimethylbenzene.
| Compound Name | 2-decoxy-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 83057478 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 2-decoxy-1,3-dimethylbenzene |
| SMILES | CCCCCCCCCCOc1c(C)cccc1C |
| InChI | InChI=1S/C18H30O/c1-4-5-6-7-8-9-10-11-15-19-18-16(2)13-12-14-17(18)3/h12-14H,4-11,15H2,1-3H3 |
| InChIKey | NNVWQPVJKVMLMK-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|