About 2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane
2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane (PubChem CID 161403557) has the molecular formula C28H45IO2
and a molecular weight of 540.57 g/mol. Its IUPAC name is 2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane.
Molecular Properties
| Compound Name | 2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane |
| PubChem CID | 161403557 |
| Molecular Formula | C28H45IO2 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane |
| SMILES | CCCCCCI.CCCCCCOc1c(C)cccc1C.Cc1cccc(C)c1O |
| InChI | InChI=1S/C14H22O.C8H10O.C6H13I/c1-4-5-6-7-11-15-14-12(2)9-8-10-13(14)3;1-6-4-3-5-7(2)8(6)9;1-2-3-4-5-6-7/h8-10H,4-7,11H2,1-3H3;3-5,9H,1-2H3;2-6H2,1H3 |
| InChIKey | VUNULEPUYYKGPS-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane?
The IUPAC name of 2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane (CID 161403557) is 2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane.
What is the SMILES notation for 2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane?
The canonical SMILES for 2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane is CCCCCCI.CCCCCCOc1c(C)cccc1C.Cc1cccc(C)c1O.
What is the InChIKey of 2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane?
The InChIKey is VUNULEPUYYKGPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O.C8H10O.C6H13I/c1-4-5-6-7-11-15-14-12(2)9-8-10-13(14)3;1-6-4-3-5-7(2)8(6)9;1-2-3-4-5-6-7/h8-10H,4-7,11H2,1-3H3;3-5,9H,1-2H3;2-6H2,1H3.
What are the key properties of 2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane?
2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane has a molecular weight of 540.57 g/mol, XLogP of 9.27, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylphenol;2-hexoxy-1,3-dimethylbenzene;1-iodohexane is sourced from PubChem (CID 161403557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).