C16H27NO — CID 2058755
N,N-diethyl-5-(2-methylphenoxy)pentan-1-amine (PubChem CID 2058755) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is N,N-diethyl-5-(2-methylphenoxy)pentan-1-amine.
| Compound Name | N,N-diethyl-5-(2-methylphenoxy)pentan-1-amine |
|---|---|
| PubChem CID | 2058755 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N,N-diethyl-5-(2-methylphenoxy)pentan-1-amine |
| SMILES | CCN(CC)CCCCCOc1ccccc1C |
| InChI | InChI=1S/C16H27NO/c1-4-17(5-2)13-9-6-10-14-18-16-12-8-7-11-15(16)3/h7-8,11-12H,4-6,9-10,13-14H2,1-3H3 |
| InChIKey | IPTVSYDKZYAXAR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|