C18H31NO — CID 2298137
4-[2-[(2R)-butan-2-yl]phenoxy]-N,N-diethylbutan-1-amine (PubChem CID 2298137) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 4-[2-[(2R)-butan-2-yl]phenoxy]-N,N-diethylbutan-1-amine.
| Compound Name | 4-[2-[(2R)-butan-2-yl]phenoxy]-N,N-diethylbutan-1-amine |
|---|---|
| PubChem CID | 2298137 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 4-[2-[(2R)-butan-2-yl]phenoxy]-N,N-diethylbutan-1-amine |
| SMILES | CC[C@@H](C)c1ccccc1OCCCCN(CC)CC |
| InChI | InChI=1S/C18H31NO/c1-5-16(4)17-12-8-9-13-18(17)20-15-11-10-14-19(6-2)7-3/h8-9,12-13,16H,5-7,10-11,14-15H2,1-4H3/t16-/m1/s1 |
| InChIKey | AOZBSTVIVYZVMQ-MRXNPFEDSA-N |
| XLogP | 4.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|