C16H26ClNO — CID 2232650
6-(2-chlorophenoxy)-N,N-diethylhexan-1-amine (PubChem CID 2232650) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is 6-(2-chlorophenoxy)-N,N-diethylhexan-1-amine.
| Compound Name | 6-(2-chlorophenoxy)-N,N-diethylhexan-1-amine |
|---|---|
| PubChem CID | 2232650 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 6-(2-chlorophenoxy)-N,N-diethylhexan-1-amine |
| SMILES | CCN(CC)CCCCCCOc1ccccc1Cl |
| InChI | InChI=1S/C16H26ClNO/c1-3-18(4-2)13-9-5-6-10-14-19-16-12-8-7-11-15(16)17/h7-8,11-12H,3-6,9-10,13-14H2,1-2H3 |
| InChIKey | CUUBGJUJIAPIAI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|