C42H48N2O6 — CID 58194625
2-[6-[2-(4-benzoylbenzoyl)oxyethyl-ethylamino]hexyl-ethylamino]ethyl 4-benzoylbenzoate (PubChem CID 58194625) has the molecular formula C42H48N2O6 and a molecular weight of 676.85 g/mol. Its IUPAC name is 2-[6-[2-(4-benzoylbenzoyl)oxyethyl-ethylamino]hexyl-ethylamino]ethyl 4-benzoylbenzoate.
| Compound Name | 2-[6-[2-(4-benzoylbenzoyl)oxyethyl-ethylamino]hexyl-ethylamino]ethyl 4-benzoylbenzoate |
|---|---|
| PubChem CID | 58194625 |
| Molecular Formula | C42H48N2O6 |
| Molecular Weight | 676.85 g/mol |
| Exact Mass | 676.35 |
| IUPAC Name | 2-[6-[2-(4-benzoylbenzoyl)oxyethyl-ethylamino]hexyl-ethylamino]ethyl 4-benzoylbenzoate |
| SMILES | CCN(CCCCCCN(CC)CCOC(=O)c1ccc(C(=O)c2ccccc2)cc1)CCOC(=O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H48N2O6/c1-3-43(29-31-49-41(47)37-23-19-35(20-24-37)39(45)33-15-9-7-10-16-33)27-13-5-6-14-28-44(4-2)30-32-50-42(48)38-25-21-36(22-26-38)40(46)34-17-11-8-12-18-34/h7-12,15-26H,3-6,13-14,27-32H2,1-2H3 |
| InChIKey | SWSGCHSIHNASGX-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.85 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|