About 2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate
2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate (PubChem CID 24835252) has the molecular formula C29H42N2O4
and a molecular weight of 482.67 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate |
| PubChem CID | 24835252 |
| Molecular Formula | C29H42N2O4 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(CCCc2ccc(C(=O)OCCN(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C29H42N2O4/c1-5-30(6-2)20-22-34-28(32)26-16-12-24(13-17-26)10-9-11-25-14-18-27(19-15-25)29(33)35-23-21-31(7-3)8-4/h12-19H,5-11,20-23H2,1-4H3 |
| InChIKey | KEEBAPNYJCNUTI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate?
The IUPAC name of 2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate (CID 24835252) is 2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate.
What is the SMILES notation for 2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate?
The canonical SMILES for 2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate is CCN(CC)CCOC(=O)c1ccc(CCCc2ccc(C(=O)OCCN(CC)CC)cc2)cc1.
What is the InChIKey of 2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate?
The InChIKey is KEEBAPNYJCNUTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H42N2O4/c1-5-30(6-2)20-22-34-28(32)26-16-12-24(13-17-26)10-9-11-25-14-18-27(19-15-25)29(33)35-23-21-31(7-3)8-4/h12-19H,5-11,20-23H2,1-4H3.
What are the key properties of 2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate?
2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate has a molecular weight of 482.67 g/mol, XLogP of 4.86, 16 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 4-[3-[4-[2-(diethylamino)ethoxycarbonyl]phenyl]propyl]benzoate is sourced from PubChem (CID 24835252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).