About 2-(Diethylamino)ethyl 4-nitrobenzoate hydrochloride
2-(Diethylamino)ethyl 4-nitrobenzoate hydrochloride (PubChem CID 12718038) has the molecular formula C13H19ClN2O4
and a molecular weight of 302.75 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-nitrobenzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-(Diethylamino)ethyl 4-nitrobenzoate hydrochloride |
| PubChem CID | 12718038 |
| Molecular Formula | C13H19ClN2O4 |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-(diethylamino)ethyl 4-nitrobenzoate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)C1=CC=C(C=C1)[N+](=O)[O-].Cl |
| InChI | InChI=1S/C13H18N2O4.ClH/c1-3-14(4-2)9-10-19-13(16)11-5-7-12(8-6-11)15(17)18;/h5-8H,3-4,9-10H2,1-2H3;1H |
| InChIKey | AADBHTMTDNASOJ-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 75.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | 292 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(Diethylamino)ethyl 4-nitrobenzoate hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(Diethylamino)ethyl 4-nitrobenzoate hydrochloride?
The IUPAC name of 2-(Diethylamino)ethyl 4-nitrobenzoate hydrochloride (CID 12718038) is 2-(diethylamino)ethyl 4-nitrobenzoate;hydrochloride.
What is the SMILES notation for 2-(Diethylamino)ethyl 4-nitrobenzoate hydrochloride?
The canonical SMILES for 2-(Diethylamino)ethyl 4-nitrobenzoate hydrochloride is CCN(CC)CCOC(=O)C1=CC=C(C=C1)[N+](=O)[O-].Cl.
What is the InChIKey of 2-(Diethylamino)ethyl 4-nitrobenzoate hydrochloride?
The InChIKey is AADBHTMTDNASOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4.ClH/c1-3-14(4-2)9-10-19-13(16)11-5-7-12(8-6-11)15(17)18;/h5-8H,3-4,9-10H2,1-2H3;1H.
What are the key properties of 2-(Diethylamino)ethyl 4-nitrobenzoate hydrochloride?
2-(Diethylamino)ethyl 4-nitrobenzoate hydrochloride has a molecular weight of 302.75 g/mol, XLogP of not available, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(Diethylamino)ethyl 4-nitrobenzoate hydrochloride is sourced from PubChem (CID 12718038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).