C21H28N2O — CID 59499353
N-[2-(diethylamino)ethyl]-3,3-diphenylpropanamide (PubChem CID 59499353) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-3,3-diphenylpropanamide.
| Compound Name | N-[2-(diethylamino)ethyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 59499353 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-3,3-diphenylpropanamide |
| SMILES | CCN(CC)CCNC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O/c1-3-23(4-2)16-15-22-21(24)17-20(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20H,3-4,15-17H2,1-2H3,(H,22,24) |
| InChIKey | UAPUUIVXGNKUEL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |