C18H29N3O2 — CID 41165153
N-[2-(diethylamino)ethyl]-N'-[(1S)-1-phenylethyl]butanediamide (PubChem CID 41165153) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N'-[(1S)-1-phenylethyl]butanediamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N'-[(1S)-1-phenylethyl]butanediamide |
|---|---|
| PubChem CID | 41165153 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N'-[(1S)-1-phenylethyl]butanediamide |
| SMILES | CCN(CC)CCNC(=O)CCC(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H29N3O2/c1-4-21(5-2)14-13-19-17(22)11-12-18(23)20-15(3)16-9-7-6-8-10-16/h6-10,15H,4-5,11-14H2,1-3H3,(H,19,22)(H,20,23)/t15-/m0/s1 |
| InChIKey | ACVRKJFWYSGKRX-HNNXBMFYSA-N |
| XLogP | 2.10 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |