C19H25ClN2O — CID 119508377
N-[2-(ethylamino)ethyl]-3,3-diphenylpropanamide;hydrochloride (PubChem CID 119508377) has the molecular formula C19H25ClN2O and a molecular weight of 332.88 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-3,3-diphenylpropanamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-3,3-diphenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119508377 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-3,3-diphenylpropanamide;hydrochloride |
| SMILES | CCNCCNC(=O)CC(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C19H24N2O.ClH/c1-2-20-13-14-21-19(22)15-18(16-9-5-3-6-10-16)17-11-7-4-8-12-17;/h3-12,18,20H,2,13-15H2,1H3,(H,21,22);1H |
| InChIKey | HXFOFPWNWITPLW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|