C15H24ClNO — CID 2249602
3-(4-chloro-2,6-dimethylphenoxy)-N,N-diethylpropan-1-amine (PubChem CID 2249602) has the molecular formula C15H24ClNO and a molecular weight of 269.82 g/mol. Its IUPAC name is 3-(4-chloro-2,6-dimethylphenoxy)-N,N-diethylpropan-1-amine.
| Compound Name | 3-(4-chloro-2,6-dimethylphenoxy)-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 2249602 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 3-(4-chloro-2,6-dimethylphenoxy)-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C15H24ClNO/c1-5-17(6-2)8-7-9-18-15-12(3)10-14(16)11-13(15)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | AQLCQKIRNLJUGA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|