C18H20Cl2O2 — CID 123242846
5-chloro-2-[2-(4-chloro-2,6-dimethylphenoxy)ethoxy]-1,3-dimethylbenzene (PubChem CID 123242846) has the molecular formula C18H20Cl2O2 and a molecular weight of 339.26 g/mol. Its IUPAC name is 5-chloro-2-[2-(4-chloro-2,6-dimethylphenoxy)ethoxy]-1,3-dimethylbenzene.
| Compound Name | 5-chloro-2-[2-(4-chloro-2,6-dimethylphenoxy)ethoxy]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 123242846 |
| Molecular Formula | C18H20Cl2O2 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 5-chloro-2-[2-(4-chloro-2,6-dimethylphenoxy)ethoxy]-1,3-dimethylbenzene |
| SMILES | Cc1cc(Cl)cc(C)c1OCCOc1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C18H20Cl2O2/c1-11-7-15(19)8-12(2)17(11)21-5-6-22-18-13(3)9-16(20)10-14(18)4/h7-10H,5-6H2,1-4H3 |
| InChIKey | LBKUEJBNNVIRAB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|