C15H24ClNO — CID 63507030
N-[2-(4-chloro-2,6-dimethylphenoxy)ethyl]-3-methylbutan-1-amine (PubChem CID 63507030) has the molecular formula C15H24ClNO and a molecular weight of 269.82 g/mol. Its IUPAC name is N-[2-(4-chloro-2,6-dimethylphenoxy)ethyl]-3-methylbutan-1-amine.
| Compound Name | N-[2-(4-chloro-2,6-dimethylphenoxy)ethyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 63507030 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | N-[2-(4-chloro-2,6-dimethylphenoxy)ethyl]-3-methylbutan-1-amine |
| SMILES | Cc1cc(Cl)cc(C)c1OCCNCCC(C)C |
| InChI | InChI=1S/C15H24ClNO/c1-11(2)5-6-17-7-8-18-15-12(3)9-14(16)10-13(15)4/h9-11,17H,5-8H2,1-4H3 |
| InChIKey | YQAGEWNCHKYNMA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|