C10H14Cl3NO — CID 44828457
2-(2,4-dichloro-6-methylphenoxy)-N-methylethanamine;hydrochloride (PubChem CID 44828457) has the molecular formula C10H14Cl3NO and a molecular weight of 270.59 g/mol. Its IUPAC name is 2-(2,4-dichloro-6-methylphenoxy)-N-methylethanamine;hydrochloride.
| Compound Name | 2-(2,4-dichloro-6-methylphenoxy)-N-methylethanamine;hydrochloride |
|---|---|
| PubChem CID | 44828457 |
| Molecular Formula | C10H14Cl3NO |
| Molecular Weight | 270.59 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 2-(2,4-dichloro-6-methylphenoxy)-N-methylethanamine;hydrochloride |
| SMILES | CNCCOc1c(C)cc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C10H13Cl2NO.ClH/c1-7-5-8(11)6-9(12)10(7)14-4-3-13-2;/h5-6,13H,3-4H2,1-2H3;1H |
| InChIKey | BAAMEVMFDHTLFM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|