C8H7Cl2FO — CID 130766678
1,5-dichloro-2-(fluoromethoxy)-3-methylbenzene (PubChem CID 130766678) has the molecular formula C8H7Cl2FO and a molecular weight of 209.05 g/mol. Its IUPAC name is 1,5-dichloro-2-(fluoromethoxy)-3-methylbenzene.
| Compound Name | 1,5-dichloro-2-(fluoromethoxy)-3-methylbenzene |
|---|---|
| PubChem CID | 130766678 |
| Molecular Formula | C8H7Cl2FO |
| Molecular Weight | 209.05 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | 1,5-dichloro-2-(fluoromethoxy)-3-methylbenzene |
| SMILES | Cc1cc(Cl)cc(Cl)c1OCF |
| InChI | InChI=1S/C8H7Cl2FO/c1-5-2-6(9)3-7(10)8(5)12-4-11/h2-3H,4H2,1H3 |
| InChIKey | WDZPCSXMGVKVFD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.05 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |