C17H18Cl2O3 — CID 4302361
1,5-dichloro-2-[3-(4-methoxyphenoxy)propoxy]-3-methylbenzene (PubChem CID 4302361) has the molecular formula C17H18Cl2O3 and a molecular weight of 341.23 g/mol. Its IUPAC name is 1,5-dichloro-2-[3-(4-methoxyphenoxy)propoxy]-3-methylbenzene.
| Compound Name | 1,5-dichloro-2-[3-(4-methoxyphenoxy)propoxy]-3-methylbenzene |
|---|---|
| PubChem CID | 4302361 |
| Molecular Formula | C17H18Cl2O3 |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1,5-dichloro-2-[3-(4-methoxyphenoxy)propoxy]-3-methylbenzene |
| SMILES | COc1ccc(OCCCOc2c(C)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2O3/c1-12-10-13(18)11-16(19)17(12)22-9-3-8-21-15-6-4-14(20-2)5-7-15/h4-7,10-11H,3,8-9H2,1-2H3 |
| InChIKey | JUFAXMOQLSECNT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|