C19H23BrO4 — CID 2282940
5-bromo-2-[2-[2-(4-methoxyphenoxy)ethoxy]ethoxy]-1,3-dimethylbenzene (PubChem CID 2282940) has the molecular formula C19H23BrO4 and a molecular weight of 395.29 g/mol. Its IUPAC name is 5-bromo-2-[2-[2-(4-methoxyphenoxy)ethoxy]ethoxy]-1,3-dimethylbenzene.
| Compound Name | 5-bromo-2-[2-[2-(4-methoxyphenoxy)ethoxy]ethoxy]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 2282940 |
| Molecular Formula | C19H23BrO4 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 5-bromo-2-[2-[2-(4-methoxyphenoxy)ethoxy]ethoxy]-1,3-dimethylbenzene |
| SMILES | COc1ccc(OCCOCCOc2c(C)cc(Br)cc2C)cc1 |
| InChI | InChI=1S/C19H23BrO4/c1-14-12-16(20)13-15(2)19(14)24-11-9-22-8-10-23-18-6-4-17(21-3)5-7-18/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | DULFBKWWKKIBPJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|