C16H16Cl2O3 — CID 2252113
2,4-dichloro-1-[3-(4-methoxyphenoxy)propoxy]benzene (PubChem CID 2252113) has the molecular formula C16H16Cl2O3 and a molecular weight of 327.21 g/mol. Its IUPAC name is 2,4-dichloro-1-[3-(4-methoxyphenoxy)propoxy]benzene.
| Compound Name | 2,4-dichloro-1-[3-(4-methoxyphenoxy)propoxy]benzene |
|---|---|
| PubChem CID | 2252113 |
| Molecular Formula | C16H16Cl2O3 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2,4-dichloro-1-[3-(4-methoxyphenoxy)propoxy]benzene |
| SMILES | COc1ccc(OCCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2O3/c1-19-13-4-6-14(7-5-13)20-9-2-10-21-16-8-3-12(17)11-15(16)18/h3-8,11H,2,9-10H2,1H3 |
| InChIKey | QBIHMAHOTJKICK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|