C7H4ClF3O — CID 130969013
5-chloro-1,3-difluoro-2-(fluoromethoxy)benzene (PubChem CID 130969013) has the molecular formula C7H4ClF3O and a molecular weight of 196.56 g/mol. Its IUPAC name is 5-chloro-1,3-difluoro-2-(fluoromethoxy)benzene.
| Compound Name | 5-chloro-1,3-difluoro-2-(fluoromethoxy)benzene |
|---|---|
| PubChem CID | 130969013 |
| Molecular Formula | C7H4ClF3O |
| Molecular Weight | 196.56 g/mol |
| Exact Mass | 195.99 |
| IUPAC Name | 5-chloro-1,3-difluoro-2-(fluoromethoxy)benzene |
| SMILES | FCOc1c(F)cc(Cl)cc1F |
| InChI | InChI=1S/C7H4ClF3O/c8-4-1-5(10)7(12-3-9)6(11)2-4/h1-2H,3H2 |
| InChIKey | HARCVYBAHVMFQN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |