C7H5F3O — CID 140973526
1,3-difluoro-2-(fluoromethoxy)benzene (PubChem CID 140973526) has the molecular formula C7H5F3O and a molecular weight of 162.11 g/mol. Its IUPAC name is 1,3-difluoro-2-(fluoromethoxy)benzene.
| Compound Name | 1,3-difluoro-2-(fluoromethoxy)benzene |
|---|---|
| PubChem CID | 140973526 |
| Molecular Formula | C7H5F3O |
| Molecular Weight | 162.11 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 1,3-difluoro-2-(fluoromethoxy)benzene |
| SMILES | FCOc1c(F)cccc1F |
| InChI | InChI=1S/C7H5F3O/c8-4-11-7-5(9)2-1-3-6(7)10/h1-3H,4H2 |
| InChIKey | LTNFGDTYTYHDJT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.11 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |