C12H17F2NO — CID 68648906
6-(2,6-difluorophenoxy)hexan-1-amine (PubChem CID 68648906) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is 6-(2,6-difluorophenoxy)hexan-1-amine.
| Compound Name | 6-(2,6-difluorophenoxy)hexan-1-amine |
|---|---|
| PubChem CID | 68648906 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 6-(2,6-difluorophenoxy)hexan-1-amine |
| SMILES | NCCCCCCOc1c(F)cccc1F |
| InChI | InChI=1S/C12H17F2NO/c13-10-6-5-7-11(14)12(10)16-9-4-2-1-3-8-15/h5-7H,1-4,8-9,15H2 |
| InChIKey | SYZQZUWJGGNPGL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|