About 3-fluoro-2-hexoxyaniline
3-fluoro-2-hexoxyaniline (PubChem CID 104831272) has the molecular formula C12H18FNO
and a molecular weight of 211.28 g/mol. Its IUPAC name is 3-fluoro-2-hexoxyaniline.
Molecular Properties
| Compound Name | 3-fluoro-2-hexoxyaniline |
| PubChem CID | 104831272 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 3-fluoro-2-hexoxyaniline |
| SMILES | CCCCCCOc1c(N)cccc1F |
| InChI | InChI=1S/C12H18FNO/c1-2-3-4-5-9-15-12-10(13)7-6-8-11(12)14/h6-8H,2-5,9,14H2,1H3 |
| InChIKey | KARDATJHDPTREE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-2-hexoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2-hexoxyaniline?
The IUPAC name of 3-fluoro-2-hexoxyaniline (CID 104831272) is 3-fluoro-2-hexoxyaniline.
What is the SMILES notation for 3-fluoro-2-hexoxyaniline?
The canonical SMILES for 3-fluoro-2-hexoxyaniline is CCCCCCOc1c(N)cccc1F.
What is the InChIKey of 3-fluoro-2-hexoxyaniline?
The InChIKey is KARDATJHDPTREE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FNO/c1-2-3-4-5-9-15-12-10(13)7-6-8-11(12)14/h6-8H,2-5,9,14H2,1H3.
What are the key properties of 3-fluoro-2-hexoxyaniline?
3-fluoro-2-hexoxyaniline has a molecular weight of 211.28 g/mol, XLogP of 3.37, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2-hexoxyaniline is sourced from PubChem (CID 104831272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).