C12H15ClF2O — CID 81268506
2-(6-chlorohexoxy)-1,3-difluorobenzene (PubChem CID 81268506) has the molecular formula C12H15ClF2O and a molecular weight of 248.70 g/mol. Its IUPAC name is 2-(6-chlorohexoxy)-1,3-difluorobenzene.
| Compound Name | 2-(6-chlorohexoxy)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 81268506 |
| Molecular Formula | C12H15ClF2O |
| Molecular Weight | 248.70 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-(6-chlorohexoxy)-1,3-difluorobenzene |
| SMILES | Fc1cccc(F)c1OCCCCCCCl |
| InChI | InChI=1S/C12H15ClF2O/c13-8-3-1-2-4-9-16-12-10(14)6-5-7-11(12)15/h5-7H,1-4,8-9H2 |
| InChIKey | OWJHVTGSOOUCGB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.70 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|