6-(2,6-difluorophenoxy)hexanoic acid

C12H14F2O3 — CID 81269433

IUPAC6-(2,6-difluorophenoxy)hexanoic acid
SMILESO=C(O)CCCCCOc1c(F)cccc1F
InChIInChI=1S/C12H14F2O3/c13-9-5-4-6-10(14)12(9)17-8-3-1-2-7-11(15)16/h4-6H,1-3,7-8H2,(H,15,16)
InChIKeySIYIZULUVXGGFP-UHFFFAOYSA-N
MW244.24 g/mol
LogP2.99
Rot. Bonds7

About 6-(2,6-difluorophenoxy)hexanoic acid

6-(2,6-difluorophenoxy)hexanoic acid (PubChem CID 81269433) has the molecular formula C12H14F2O3 and a molecular weight of 244.24 g/mol. Its IUPAC name is 6-(2,6-difluorophenoxy)hexanoic acid.

Molecular Properties

Compound Name6-(2,6-difluorophenoxy)hexanoic acid
PubChem CID81269433
Molecular FormulaC12H14F2O3
Molecular Weight244.24 g/mol
Exact Mass244.09
IUPAC Name6-(2,6-difluorophenoxy)hexanoic acid
SMILESO=C(O)CCCCCOc1c(F)cccc1F
InChIInChI=1S/C12H14F2O3/c13-9-5-4-6-10(14)12(9)17-8-3-1-2-7-11(15)16/h4-6H,1-3,7-8H2,(H,15,16)
InChIKeySIYIZULUVXGGFP-UHFFFAOYSA-N
XLogP2.99
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.24
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-(2,6-difluorophenoxy)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,6-difluorophenoxy)hexanoic acid?
The IUPAC name of 6-(2,6-difluorophenoxy)hexanoic acid (CID 81269433) is 6-(2,6-difluorophenoxy)hexanoic acid.
What is the SMILES notation for 6-(2,6-difluorophenoxy)hexanoic acid?
The canonical SMILES for 6-(2,6-difluorophenoxy)hexanoic acid is O=C(O)CCCCCOc1c(F)cccc1F.
What is the InChIKey of 6-(2,6-difluorophenoxy)hexanoic acid?
The InChIKey is SIYIZULUVXGGFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O3/c13-9-5-4-6-10(14)12(9)17-8-3-1-2-7-11(15)16/h4-6H,1-3,7-8H2,(H,15,16).
What are the key properties of 6-(2,6-difluorophenoxy)hexanoic acid?
6-(2,6-difluorophenoxy)hexanoic acid has a molecular weight of 244.24 g/mol, XLogP of 2.99, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-difluorophenoxy)hexanoic acid is sourced from PubChem (CID 81269433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).