C12H14F2O3 — CID 81269433
6-(2,6-difluorophenoxy)hexanoic acid (PubChem CID 81269433) has the molecular formula C12H14F2O3 and a molecular weight of 244.24 g/mol. Its IUPAC name is 6-(2,6-difluorophenoxy)hexanoic acid.
| Compound Name | 6-(2,6-difluorophenoxy)hexanoic acid |
|---|---|
| PubChem CID | 81269433 |
| Molecular Formula | C12H14F2O3 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 6-(2,6-difluorophenoxy)hexanoic acid |
| SMILES | O=C(O)CCCCCOc1c(F)cccc1F |
| InChI | InChI=1S/C12H14F2O3/c13-9-5-4-6-10(14)12(9)17-8-3-1-2-7-11(15)16/h4-6H,1-3,7-8H2,(H,15,16) |
| InChIKey | SIYIZULUVXGGFP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|